Basic Info
Model NO.: FCC/USP
Nutritional Value: Nutritional
Resource: Natural
Form: Powder
Sample: Available
Transport Package: 25kgs/bag
Origin: China
Type: Xylitol
Effect: Retains Water
Odor: Odorless
Color: White
Specification: food grade
HS Code: 2905491000
Product Description
Xylitol
Specification: 98.5%
CAS No.: 87-99-0
Standard: FCC/USP/NF
Appearance: White crystal or crystalline powder.
Purity: 98.5%min,
1. Mannitol CP2005/BP/USP
2. Sorbitol CP2005/BP/USP
A. Powder
B. 70% non-crystalline
3. Xylitol
4. Maltitol
5. Erythritol
6. D-Xylose
Package: 25kg/drum or As your request.
Storage Situation: Stored in a cool and dry well-closed container. Keep away from moisture and strong light/heat.
Shelf Life: Two years when properly stored.
Delivery: Within two weeks after receiving your prepayment.
Service we can provide:
1. Mixed container, we can mix different items in one container.
2. Quality control, before shipment, free sample for test. After shipment, keep sample for 3 years
3. Prompt shipment with professional documents
4. Packing as your request, with photo before shipment.
Specification: 98.5%
CAS No.: 87-99-0
Standard: FCC/USP/NF
Appearance: White crystal or crystalline powder.
Purity: 98.5%min,
| Product name | Xylitol |
| Synonyms | XYLIT; XYLITE; D-XYLITOL; 1,2,3,4,5-PENTAHYDROXYPENTANE |
| Molecular Formula | C 5 H 12 O 5 |
| Molecular Weight | 152.15 |
| InChI | InChI=1/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5+ |
| CAS Registry Number | 87-99-0;16277-71-7 |
| EINECS | 201-788-0 |
| Molecular Structure | |
| Melting point | 92-96°C |
| Boiling point | 215~217°C |
| Water solubility | SOLUBLE |
1. Mannitol CP2005/BP/USP
2. Sorbitol CP2005/BP/USP
A. Powder
B. 70% non-crystalline
3. Xylitol
4. Maltitol
5. Erythritol
6. D-Xylose
Package: 25kg/drum or As your request.
Storage Situation: Stored in a cool and dry well-closed container. Keep away from moisture and strong light/heat.
Shelf Life: Two years when properly stored.
Delivery: Within two weeks after receiving your prepayment.
Service we can provide:
1. Mixed container, we can mix different items in one container.
2. Quality control, before shipment, free sample for test. After shipment, keep sample for 3 years
3. Prompt shipment with professional documents
4. Packing as your request, with photo before shipment.